C26H37FN6O — CID 176560393
6-[(1R,3S)-3-[4-[6-[amino-[[(Z)-1-fluoroprop-1-enyl]-methylamino]methyl]-3-pyridinyl]piperazin-1-yl]cyclopentyl]-3-ethyl-1H-pyridin-2-one (PubChem CID 176560393) has the molecular formula C26H37FN6O and a molecular weight of 468.62 g/mol. Its IUPAC name is 6-[(1R,3S)-3-[4-[6-[amino-[[(Z)-1-fluoroprop-1-enyl]-methylamino]methyl]-3-pyridinyl]piperazin-1-yl]cyclopentyl]-3-ethyl-1H-pyridin-2-one.
| Compound Name | 6-[(1R,3S)-3-[4-[6-[amino-[[(Z)-1-fluoroprop-1-enyl]-methylamino]methyl]-3-pyridinyl]piperazin-1-yl]cyclopentyl]-3-ethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 176560393 |
| Molecular Formula | C26H37FN6O |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 6-[(1R,3S)-3-[4-[6-[amino-[[(Z)-1-fluoroprop-1-enyl]-methylamino]methyl]-3-pyridinyl]piperazin-1-yl]cyclopentyl]-3-ethyl-1H-pyridin-2-one |
| SMILES | C/C=C(\F)N(C)C(N)c1ccc(N2CCN([C@H]3CC[C@@H](c4ccc(CC)c(=O)[nH]4)C3)CC2)cn1 |
| InChI | InChI=1S/C26H37FN6O/c1-4-18-7-10-22(30-26(18)34)19-6-8-20(16-19)32-12-14-33(15-13-32)21-9-11-23(29-17-21)25(28)31(3)24(27)5-2/h5,7,9-11,17,19-20,25H,4,6,8,12-16,28H2,1-3H3,(H,30,34)/b24-5+/t19-,20+,25?/m1/s1 |
| InChIKey | UQLKGNXLTGPBBM-INVYYUDESA-N |
| XLogP | 3.51 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|