C55H101NO14 — CID 176560854
formic acid;6-heptanoyloxyhexyl 9-heptanoyloxy-2-(2-oxoethyl)-2-(5-pyrrolidin-1-ylpentanoyloxy)nonanoate;6-methoxyhexyl heptanoate (PubChem CID 176560854) has the molecular formula C55H101NO14 and a molecular weight of 1000.41 g/mol. Its IUPAC name is formic acid;6-heptanoyloxyhexyl 9-heptanoyloxy-2-(2-oxoethyl)-2-(5-pyrrolidin-1-ylpentanoyloxy)nonanoate;6-methoxyhexyl heptanoate.
| Compound Name | formic acid;6-heptanoyloxyhexyl 9-heptanoyloxy-2-(2-oxoethyl)-2-(5-pyrrolidin-1-ylpentanoyloxy)nonanoate;6-methoxyhexyl heptanoate |
|---|---|
| PubChem CID | 176560854 |
| Molecular Formula | C55H101NO14 |
| Molecular Weight | 1000.41 g/mol |
| Exact Mass | 999.72 |
| IUPAC Name | formic acid;6-heptanoyloxyhexyl 9-heptanoyloxy-2-(2-oxoethyl)-2-(5-pyrrolidin-1-ylpentanoyloxy)nonanoate;6-methoxyhexyl heptanoate |
| SMILES | CCCCCCC(=O)OCCCCCCCC(CC=O)(OC(=O)CCCCN1CCCC1)C(=O)OCCCCCCOC(=O)CCCCCC.CCCCCCC(=O)OCCCCCCOC.O=CO |
| InChI | InChI=1S/C40H71NO9.C14H28O3.CH2O2/c1-3-5-7-14-24-36(43)47-33-21-11-9-10-17-27-40(28-32-42,50-38(45)26-16-18-29-41-30-19-20-31-41)39(46)49-35-23-13-12-22-34-48-37(44)25-15-8-6-4-2;1-3-4-5-8-11-14(15)17-13-10-7-6-9-12-16-2;2-1-3/h32H,3-31,33-35H2,1-2H3;3-13H2,1-2H3;1H,(H,2,3) |
| InChIKey | QPQXSTILSGPSEO-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 198.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.41 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|