C53H96N2O14 — CID 176560983
2-O-(5-methoxypentyl) 1-O,3-O-bis(5-octanoyloxypentyl) 2-(3-piperazin-1-ylpropanoyloxy)propane-1,2,3-tricarboxylate;octanal (PubChem CID 176560983) has the molecular formula C53H96N2O14 and a molecular weight of 985.35 g/mol. Its IUPAC name is 2-O-(5-methoxypentyl) 1-O,3-O-bis(5-octanoyloxypentyl) 2-(3-piperazin-1-ylpropanoyloxy)propane-1,2,3-tricarboxylate;octanal.
| Compound Name | 2-O-(5-methoxypentyl) 1-O,3-O-bis(5-octanoyloxypentyl) 2-(3-piperazin-1-ylpropanoyloxy)propane-1,2,3-tricarboxylate;octanal |
|---|---|
| PubChem CID | 176560983 |
| Molecular Formula | C53H96N2O14 |
| Molecular Weight | 985.35 g/mol |
| Exact Mass | 984.69 |
| IUPAC Name | 2-O-(5-methoxypentyl) 1-O,3-O-bis(5-octanoyloxypentyl) 2-(3-piperazin-1-ylpropanoyloxy)propane-1,2,3-tricarboxylate;octanal |
| SMILES | CCCCCCCC(=O)OCCCCCOC(=O)CC(CC(=O)OCCCCCOC(=O)CCCCCCC)(OC(=O)CCN1CCNCC1)C(=O)OCCCCCOC.CCCCCCCC=O |
| InChI | InChI=1S/C45H80N2O13.C8H16O/c1-4-6-8-10-15-23-39(48)55-32-18-13-20-34-57-42(51)37-45(44(53)59-36-22-12-17-31-54-3,60-41(50)25-28-47-29-26-46-27-30-47)38-43(52)58-35-21-14-19-33-56-40(49)24-16-11-9-7-5-2;1-2-3-4-5-6-7-8-9/h46H,4-38H2,1-3H3;8H,2-7H2,1H3 |
| InChIKey | KFPMZPAPCIYOLG-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 199.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.35 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|