C32H57NO8 — CID 176560903
1-O-ethyl 2-O,3-O-dioctyl 2-(4-pyrrolidin-1-ylbutanoyloxy)propane-1,2,3-tricarboxylate (PubChem CID 176560903) has the molecular formula C32H57NO8 and a molecular weight of 583.81 g/mol. Its IUPAC name is 1-O-ethyl 2-O,3-O-dioctyl 2-(4-pyrrolidin-1-ylbutanoyloxy)propane-1,2,3-tricarboxylate.
| Compound Name | 1-O-ethyl 2-O,3-O-dioctyl 2-(4-pyrrolidin-1-ylbutanoyloxy)propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 176560903 |
| Molecular Formula | C32H57NO8 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.41 |
| IUPAC Name | 1-O-ethyl 2-O,3-O-dioctyl 2-(4-pyrrolidin-1-ylbutanoyloxy)propane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCOC(=O)CC(CC(=O)OCC)(OC(=O)CCCN1CCCC1)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C32H57NO8/c1-4-7-9-11-13-17-24-39-30(36)27-32(26-29(35)38-6-3,31(37)40-25-18-14-12-10-8-5-2)41-28(34)20-19-23-33-21-15-16-22-33/h4-27H2,1-3H3 |
| InChIKey | PCDSUPKEJOQHFX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|