C36H47F3N6O3 — CID 176563367
2-[6-amino-5-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]-4,6-difluorophenol (PubChem CID 176563367) has the molecular formula C36H47F3N6O3 and a molecular weight of 668.80 g/mol. Its IUPAC name is 2-[6-amino-5-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]-4,6-difluorophenol.
| Compound Name | 2-[6-amino-5-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]-4,6-difluorophenol |
|---|---|
| PubChem CID | 176563367 |
| Molecular Formula | C36H47F3N6O3 |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.37 |
| IUPAC Name | 2-[6-amino-5-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]-4,6-difluorophenol |
| SMILES | CCCCOC(OCCCC)C1CCN(c2cc(N3C4CCC3CN(c3cc(-c5cc(F)cc(F)c5O)nnc3N)C4)ccc2F)CC1 |
| InChI | InChI=1S/C36H47F3N6O3/c1-3-5-15-47-36(48-16-6-4-2)23-11-13-43(14-12-23)32-19-25(9-10-29(32)38)45-26-7-8-27(45)22-44(21-26)33-20-31(41-42-35(33)40)28-17-24(37)18-30(39)34(28)46/h9-10,17-20,23,26-27,36,46H,3-8,11-16,21-22H2,1-2H3,(H2,40,42) |
| InChIKey | SPVZNPZFPBGWOA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|