C26H42FN3O2 — CID 176563550
8-[5-[4-(dibutoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 176563550) has the molecular formula C26H42FN3O2 and a molecular weight of 447.64 g/mol. Its IUPAC name is 8-[5-[4-(dibutoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 8-[5-[4-(dibutoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 176563550 |
| Molecular Formula | C26H42FN3O2 |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | 8-[5-[4-(dibutoxymethyl)piperidin-1-yl]-2-fluorophenyl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCCCOC(OCCCC)C1CCN(c2ccc(F)c(N3C4CCC3CNC4)c2)CC1 |
| InChI | InChI=1S/C26H42FN3O2/c1-3-5-15-31-26(32-16-6-4-2)20-11-13-29(14-12-20)21-9-10-24(27)25(17-21)30-22-7-8-23(30)19-28-18-22/h9-10,17,20,22-23,26,28H,3-8,11-16,18-19H2,1-2H3 |
| InChIKey | SGVQVMMCDPCMHT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|