C23H35ClFNO2 — CID 176563871
7-(5-chloro-2-fluorophenyl)-2-(dibutoxymethyl)-7-azaspiro[3.5]nonane (PubChem CID 176563871) has the molecular formula C23H35ClFNO2 and a molecular weight of 411.99 g/mol. Its IUPAC name is 7-(5-chloro-2-fluorophenyl)-2-(dibutoxymethyl)-7-azaspiro[3.5]nonane.
| Compound Name | 7-(5-chloro-2-fluorophenyl)-2-(dibutoxymethyl)-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 176563871 |
| Molecular Formula | C23H35ClFNO2 |
| Molecular Weight | 411.99 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 7-(5-chloro-2-fluorophenyl)-2-(dibutoxymethyl)-7-azaspiro[3.5]nonane |
| SMILES | CCCCOC(OCCCC)C1CC2(CCN(c3cc(Cl)ccc3F)CC2)C1 |
| InChI | InChI=1S/C23H35ClFNO2/c1-3-5-13-27-22(28-14-6-4-2)18-16-23(17-18)9-11-26(12-10-23)21-15-19(24)7-8-20(21)25/h7-8,15,18,22H,3-6,9-14,16-17H2,1-2H3 |
| InChIKey | CFABJYJDFONYBD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.99 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|