C30H48ClFN6O2 — CID 176563656
(3E)-4-chloro-2-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-diene-1,1,4-triamine (PubChem CID 176563656) has the molecular formula C30H48ClFN6O2 and a molecular weight of 579.21 g/mol. Its IUPAC name is (3E)-4-chloro-2-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3E)-4-chloro-2-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 176563656 |
| Molecular Formula | C30H48ClFN6O2 |
| Molecular Weight | 579.21 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | (3E)-4-chloro-2-[8-[3-[4-(dibutoxymethyl)piperidin-1-yl]-4-fluorophenyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]buta-1,3-diene-1,1,4-triamine |
| SMILES | CCCCOC(OCCCC)C1CCN(c2cc(N3C4CCC3CN(C(/C=C(\N)Cl)=C(N)N)C4)ccc2F)CC1 |
| InChI | InChI=1S/C30H48ClFN6O2/c1-3-5-15-39-30(40-16-6-4-2)21-11-13-36(14-12-21)26-17-22(9-10-25(26)32)38-23-7-8-24(38)20-37(19-23)27(29(34)35)18-28(31)33/h9-10,17-18,21,23-24,30H,3-8,11-16,19-20,33-35H2,1-2H3/b28-18- |
| InChIKey | HNIRVTMXOPIGAX-VEILYXNESA-N |
| XLogP | 4.78 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.21 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|