C10H10ClIN3O2P — CID 176566248
ethyl 6-chloro-1-iodophosphanyl-3-methylpyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 176566248) has the molecular formula C10H10ClIN3O2P and a molecular weight of 397.54 g/mol. Its IUPAC name is ethyl 6-chloro-1-iodophosphanyl-3-methylpyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | ethyl 6-chloro-1-iodophosphanyl-3-methylpyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 176566248 |
| Molecular Formula | C10H10ClIN3O2P |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | ethyl 6-chloro-1-iodophosphanyl-3-methylpyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)nc2c1c(C)nn2PI |
| InChI | InChI=1S/C10H10ClIN3O2P/c1-3-17-10(16)6-4-7(11)13-9-8(6)5(2)14-15(9)18-12/h4,18H,3H2,1-2H3 |
| InChIKey | CCTBLRJITZDQMX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|