C39H57NO8 — CID 176567569
[5-[2-[4-[2-[4-[2-[2-[ethyl(prop-2-enoyloxy)amino]-2-hydroxyethoxy]butan-2-yl]phenyl]propan-2-yl]phenyl]butan-2-yloxy]-4-hydroxy-2-methylpentan-2-yl] prop-2-enoate (PubChem CID 176567569) has the molecular formula C39H57NO8 and a molecular weight of 667.88 g/mol. Its IUPAC name is [5-[2-[4-[2-[4-[2-[2-[ethyl(prop-2-enoyloxy)amino]-2-hydroxyethoxy]butan-2-yl]phenyl]propan-2-yl]phenyl]butan-2-yloxy]-4-hydroxy-2-methylpentan-2-yl] prop-2-enoate.
| Compound Name | [5-[2-[4-[2-[4-[2-[2-[ethyl(prop-2-enoyloxy)amino]-2-hydroxyethoxy]butan-2-yl]phenyl]propan-2-yl]phenyl]butan-2-yloxy]-4-hydroxy-2-methylpentan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 176567569 |
| Molecular Formula | C39H57NO8 |
| Molecular Weight | 667.88 g/mol |
| Exact Mass | 667.41 |
| IUPAC Name | [5-[2-[4-[2-[4-[2-[2-[ethyl(prop-2-enoyloxy)amino]-2-hydroxyethoxy]butan-2-yl]phenyl]propan-2-yl]phenyl]butan-2-yloxy]-4-hydroxy-2-methylpentan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)ON(CC)C(O)COC(C)(CC)c1ccc(C(C)(C)c2ccc(C(C)(CC)OCC(O)CC(C)(C)OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C39H57NO8/c1-12-34(43)47-36(6,7)25-32(41)26-45-38(10,14-3)30-21-17-28(18-22-30)37(8,9)29-19-23-31(24-20-29)39(11,15-4)46-27-33(42)40(16-5)48-35(44)13-2/h12-13,17-24,32-33,41-42H,1-2,14-16,25-27H2,3-11H3 |
| InChIKey | SHRJSIPLYQGECE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.88 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|