C13H24N4 — CID 176569816
[5-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,3,6-tetrahydropyridin-3-yl]methanamine (PubChem CID 176569816) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is [5-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,3,6-tetrahydropyridin-3-yl]methanamine.
| Compound Name | [5-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,3,6-tetrahydropyridin-3-yl]methanamine |
|---|---|
| PubChem CID | 176569816 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | [5-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,3,6-tetrahydropyridin-3-yl]methanamine |
| SMILES | NCC1C=C(C2CNC3NCCCC32)CNC1 |
| InChI | InChI=1S/C13H24N4/c14-5-9-4-10(7-15-6-9)12-8-17-13-11(12)2-1-3-16-13/h4,9,11-13,15-17H,1-3,5-8,14H2 |
| InChIKey | NKESXWUOPDIARQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|