C21H23FN2O2S — CID 176573471
1-[4-ethylsulfanyl-2-(3-fluoro-7-methoxy-1H-indol-2-yl)phenyl]pyrrolidin-3-ol (PubChem CID 176573471) has the molecular formula C21H23FN2O2S and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[4-ethylsulfanyl-2-(3-fluoro-7-methoxy-1H-indol-2-yl)phenyl]pyrrolidin-3-ol.
| Compound Name | 1-[4-ethylsulfanyl-2-(3-fluoro-7-methoxy-1H-indol-2-yl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 176573471 |
| Molecular Formula | C21H23FN2O2S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-[4-ethylsulfanyl-2-(3-fluoro-7-methoxy-1H-indol-2-yl)phenyl]pyrrolidin-3-ol |
| SMILES | CCSc1ccc(N2CCC(O)C2)c(-c2[nH]c3c(OC)cccc3c2F)c1 |
| InChI | InChI=1S/C21H23FN2O2S/c1-3-27-14-7-8-17(24-10-9-13(25)12-24)16(11-14)21-19(22)15-5-4-6-18(26-2)20(15)23-21/h4-8,11,13,23,25H,3,9-10,12H2,1-2H3 |
| InChIKey | ANESONTUCCLEHA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |