About 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine
3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 176573664) has the molecular formula C11H13ClN2O
and a molecular weight of 224.69 g/mol. Its IUPAC name is 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 176573664 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | COc1cc2[nH]c(C(C)C)c(Cl)c2cn1 |
| InChI | InChI=1S/C11H13ClN2O/c1-6(2)11-10(12)7-5-13-9(15-3)4-8(7)14-11/h4-6,14H,1-3H3 |
| InChIKey | GOKFGTGBJFXWEW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine (CID 176573664) is 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine is COc1cc2[nH]c(C(C)C)c(Cl)c2cn1.
What is the InChIKey of 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is GOKFGTGBJFXWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O/c1-6(2)11-10(12)7-5-13-9(15-3)4-8(7)14-11/h4-6,14H,1-3H3.
What are the key properties of 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine?
3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 224.69 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-methoxy-2-propan-2-yl-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 176573664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).