C15H19N3O — CID 168762237
12-cyclopropyl-5-methoxy-4,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene (PubChem CID 168762237) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 12-cyclopropyl-5-methoxy-4,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene.
| Compound Name | 12-cyclopropyl-5-methoxy-4,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene |
|---|---|
| PubChem CID | 168762237 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 12-cyclopropyl-5-methoxy-4,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene |
| SMILES | COc1cc2[nH]c3c(c2cn1)CCN(C1CC1)CC3 |
| InChI | InChI=1S/C15H19N3O/c1-19-15-8-14-12(9-16-15)11-4-6-18(10-2-3-10)7-5-13(11)17-14/h8-10,17H,2-7H2,1H3 |
| InChIKey | MZAYUYWEMJBNOX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |