C25H37ClN2O3 — CID 176575975
3-[1-(2-chloroacetyl)piperidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide;cyclohexane (PubChem CID 176575975) has the molecular formula C25H37ClN2O3 and a molecular weight of 449.04 g/mol. Its IUPAC name is 3-[1-(2-chloroacetyl)piperidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide;cyclohexane.
| Compound Name | 3-[1-(2-chloroacetyl)piperidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide;cyclohexane |
|---|---|
| PubChem CID | 176575975 |
| Molecular Formula | C25H37ClN2O3 |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 3-[1-(2-chloroacetyl)piperidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide;cyclohexane |
| SMILES | C1CCCCC1.CC(C)C(=O)CNC(=O)c1cccc(C2CCCN(C(=O)CCl)C2)c1 |
| InChI | InChI=1S/C19H25ClN2O3.C6H12/c1-13(2)17(23)11-21-19(25)15-6-3-5-14(9-15)16-7-4-8-22(12-16)18(24)10-20;1-2-4-6-5-3-1/h3,5-6,9,13,16H,4,7-8,10-12H2,1-2H3,(H,21,25);1-6H2 |
| InChIKey | HFLBSDAXSUXLJS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|