C21H29N3O4 — CID 176579203
3-[1-[2-(oxetan-3-ylamino)acetyl]piperidin-3-yl]-N-(2-oxobutyl)benzamide (PubChem CID 176579203) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[1-[2-(oxetan-3-ylamino)acetyl]piperidin-3-yl]-N-(2-oxobutyl)benzamide.
| Compound Name | 3-[1-[2-(oxetan-3-ylamino)acetyl]piperidin-3-yl]-N-(2-oxobutyl)benzamide |
|---|---|
| PubChem CID | 176579203 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-[1-[2-(oxetan-3-ylamino)acetyl]piperidin-3-yl]-N-(2-oxobutyl)benzamide |
| SMILES | CCC(=O)CNC(=O)c1cccc(C2CCCN(C(=O)CNC3COC3)C2)c1 |
| InChI | InChI=1S/C21H29N3O4/c1-2-19(25)10-23-21(27)16-6-3-5-15(9-16)17-7-4-8-24(12-17)20(26)11-22-18-13-28-14-18/h3,5-6,9,17-18,22H,2,4,7-8,10-14H2,1H3,(H,23,27) |
| InChIKey | DZSFDWLQUHUHPB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |