C25H36N2O3 — CID 176576174
cyclohexane;3-[1-(cyclopropanecarbonyl)azetidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide (PubChem CID 176576174) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is cyclohexane;3-[1-(cyclopropanecarbonyl)azetidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide.
| Compound Name | cyclohexane;3-[1-(cyclopropanecarbonyl)azetidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide |
|---|---|
| PubChem CID | 176576174 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | cyclohexane;3-[1-(cyclopropanecarbonyl)azetidin-3-yl]-N-(3-methyl-2-oxobutyl)benzamide |
| SMILES | C1CCCCC1.CC(C)C(=O)CNC(=O)c1cccc(C2CN(C(=O)C3CC3)C2)c1 |
| InChI | InChI=1S/C19H24N2O3.C6H12/c1-12(2)17(22)9-20-18(23)15-5-3-4-14(8-15)16-10-21(11-16)19(24)13-6-7-13;1-2-4-6-5-3-1/h3-5,8,12-13,16H,6-7,9-11H2,1-2H3,(H,20,23);1-6H2 |
| InChIKey | OEKKFNDZRZXNEI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |