C38H48FN7O5 — CID 176582008
N-[2-[[2-[4-[1-(2-cyclohexyl-2-iminoacetyl)piperidin-4-yl]oxypiperidin-1-yl]acetyl]amino]ethyl]-2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide (PubChem CID 176582008) has the molecular formula C38H48FN7O5 and a molecular weight of 701.84 g/mol. Its IUPAC name is N-[2-[[2-[4-[1-(2-cyclohexyl-2-iminoacetyl)piperidin-4-yl]oxypiperidin-1-yl]acetyl]amino]ethyl]-2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide.
| Compound Name | N-[2-[[2-[4-[1-(2-cyclohexyl-2-iminoacetyl)piperidin-4-yl]oxypiperidin-1-yl]acetyl]amino]ethyl]-2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 176582008 |
| Molecular Formula | C38H48FN7O5 |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.37 |
| IUPAC Name | N-[2-[[2-[4-[1-(2-cyclohexyl-2-iminoacetyl)piperidin-4-yl]oxypiperidin-1-yl]acetyl]amino]ethyl]-2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzamide |
| SMILES | [H]/N=C(/C(=O)N1CCC(OC2CCN(CC(=O)NCCNC(=O)c3cc(Cc4n[nH]c(=O)c5ccccc45)ccc3F)CC2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C38H48FN7O5/c39-32-11-10-25(23-33-29-8-4-5-9-30(29)37(49)44-43-33)22-31(32)36(48)42-17-16-41-34(47)24-45-18-12-27(13-19-45)51-28-14-20-46(21-15-28)38(50)35(40)26-6-2-1-3-7-26/h4-5,8-11,22,26-28,40H,1-3,6-7,12-21,23-24H2,(H,41,47)(H,42,48)(H,44,49)/b40-35+ |
| InChIKey | HCDSBIRTBZUERF-JWVZJPBISA-N |
| XLogP | 3.57 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|