C23H25FN4O2 — CID 166090180
2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 166090180) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 166090180 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCCCC1)c1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F |
| InChI | InChI=1S/C23H25FN4O2/c24-20-9-8-16(15-21-17-6-2-3-7-18(17)23(30)27-26-21)14-19(20)22(29)25-10-13-28-11-4-1-5-12-28/h2-3,6-9,14H,1,4-5,10-13,15H2,(H,25,29)(H,27,30) |
| InChIKey | FNUODBROPBCJDQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |