C31H34FN7O3 — CID 162515622
6-amino-N-[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]pentyl]pyridine-3-carboxamide (PubChem CID 162515622) has the molecular formula C31H34FN7O3 and a molecular weight of 571.66 g/mol. Its IUPAC name is 6-amino-N-[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]pentyl]pyridine-3-carboxamide.
| Compound Name | 6-amino-N-[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]pentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162515622 |
| Molecular Formula | C31H34FN7O3 |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 6-amino-N-[5-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]pentyl]pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)NCCCCCN2CCN(C(=O)c3cc(Cc4n[nH]c(=O)c5ccccc45)ccc3F)CC2)cn1 |
| InChI | InChI=1S/C31H34FN7O3/c32-26-10-8-21(19-27-23-6-2-3-7-24(23)30(41)37-36-27)18-25(26)31(42)39-16-14-38(15-17-39)13-5-1-4-12-34-29(40)22-9-11-28(33)35-20-22/h2-3,6-11,18,20H,1,4-5,12-17,19H2,(H2,33,35)(H,34,40)(H,37,41) |
| InChIKey | UETCTDVYKQBSLW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|