C17H23BrClN3O3 — CID 176590775
tert-butyl 4-acetyl-3-(2-bromo-6-chloro-4-pyridinyl)-2-methylpiperazine-1-carboxylate (PubChem CID 176590775) has the molecular formula C17H23BrClN3O3 and a molecular weight of 432.75 g/mol. Its IUPAC name is tert-butyl 4-acetyl-3-(2-bromo-6-chloro-4-pyridinyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-acetyl-3-(2-bromo-6-chloro-4-pyridinyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176590775 |
| Molecular Formula | C17H23BrClN3O3 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | tert-butyl 4-acetyl-3-(2-bromo-6-chloro-4-pyridinyl)-2-methylpiperazine-1-carboxylate |
| SMILES | CC(=O)N1CCN(C(=O)OC(C)(C)C)C(C)C1c1cc(Cl)nc(Br)c1 |
| InChI | InChI=1S/C17H23BrClN3O3/c1-10-15(12-8-13(18)20-14(19)9-12)22(11(2)23)7-6-21(10)16(24)25-17(3,4)5/h8-10,15H,6-7H2,1-5H3 |
| InChIKey | NSOSUIREOZJMET-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|