C18H24BrClN2O3 — CID 176590687
tert-butyl 4-acetyl-3-(3-bromo-5-chlorophenyl)-2-methylpiperazine-1-carboxylate (PubChem CID 176590687) has the molecular formula C18H24BrClN2O3 and a molecular weight of 431.76 g/mol. Its IUPAC name is tert-butyl 4-acetyl-3-(3-bromo-5-chlorophenyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-acetyl-3-(3-bromo-5-chlorophenyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176590687 |
| Molecular Formula | C18H24BrClN2O3 |
| Molecular Weight | 431.76 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | tert-butyl 4-acetyl-3-(3-bromo-5-chlorophenyl)-2-methylpiperazine-1-carboxylate |
| SMILES | CC(=O)N1CCN(C(=O)OC(C)(C)C)C(C)C1c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C18H24BrClN2O3/c1-11-16(13-8-14(19)10-15(20)9-13)22(12(2)23)7-6-21(11)17(24)25-18(3,4)5/h8-11,16H,6-7H2,1-5H3 |
| InChIKey | BPWRNGRGOMEOFI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.76 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |