C18H31BrClN3O3S — CID 176677084
tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-methylsulfanylpiperazine-1-carboxylate;ethane;methanol (PubChem CID 176677084) has the molecular formula C18H31BrClN3O3S and a molecular weight of 484.89 g/mol. Its IUPAC name is tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-methylsulfanylpiperazine-1-carboxylate;ethane;methanol.
| Compound Name | tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-methylsulfanylpiperazine-1-carboxylate;ethane;methanol |
|---|---|
| PubChem CID | 176677084 |
| Molecular Formula | C18H31BrClN3O3S |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-methylsulfanylpiperazine-1-carboxylate;ethane;methanol |
| SMILES | CC.CO.CSN1CCN(C(=O)OC(C)(C)C)CC1c1cc(Cl)nc(Br)c1 |
| InChI | InChI=1S/C15H21BrClN3O2S.C2H6.CH4O/c1-15(2,3)22-14(21)19-5-6-20(23-4)11(9-19)10-7-12(16)18-13(17)8-10;2*1-2/h7-8,11H,5-6,9H2,1-4H3;1-2H3;2H,1H3 |
| InChIKey | ITTMFRRATFWCMX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|