C19H31BrClN3O3 — CID 176676781
tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-(2-methoxyethyl)piperazine-1-carboxylate;ethane (PubChem CID 176676781) has the molecular formula C19H31BrClN3O3 and a molecular weight of 464.83 g/mol. Its IUPAC name is tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-(2-methoxyethyl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-(2-methoxyethyl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 176676781 |
| Molecular Formula | C19H31BrClN3O3 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | tert-butyl 3-(2-bromo-6-chloro-4-pyridinyl)-4-(2-methoxyethyl)piperazine-1-carboxylate;ethane |
| SMILES | CC.COCCN1CCN(C(=O)OC(C)(C)C)CC1c1cc(Cl)nc(Br)c1 |
| InChI | InChI=1S/C17H25BrClN3O3.C2H6/c1-17(2,3)25-16(23)22-6-5-21(7-8-24-4)13(11-22)12-9-14(18)20-15(19)10-12;1-2/h9-10,13H,5-8,11H2,1-4H3;1-2H3 |
| InChIKey | YVFUWGRIYBDKMD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|