C18H26ClN5O2 — CID 177060297
tert-butyl 4-(5-chloro-2,3-dimethylimidazo[4,5-b]pyridin-7-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 177060297) has the molecular formula C18H26ClN5O2 and a molecular weight of 379.89 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-2,3-dimethylimidazo[4,5-b]pyridin-7-yl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-chloro-2,3-dimethylimidazo[4,5-b]pyridin-7-yl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 177060297 |
| Molecular Formula | C18H26ClN5O2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl 4-(5-chloro-2,3-dimethylimidazo[4,5-b]pyridin-7-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | Cc1nc2c(N3CCN(C(=O)OC(C)(C)C)CC3C)cc(Cl)nc2n1C |
| InChI | InChI=1S/C18H26ClN5O2/c1-11-10-23(17(25)26-18(3,4)5)7-8-24(11)13-9-14(19)21-16-15(13)20-12(2)22(16)6/h9,11H,7-8,10H2,1-6H3 |
| InChIKey | BZRAZULEAPBORG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|