About 2-ethynyl-4-propan-2-yl-1,4-oxazepane
2-ethynyl-4-propan-2-yl-1,4-oxazepane (PubChem CID 176594331) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-ethynyl-4-propan-2-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | 2-ethynyl-4-propan-2-yl-1,4-oxazepane |
| PubChem CID | 176594331 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-ethynyl-4-propan-2-yl-1,4-oxazepane |
| SMILES | C#CC1CN(C(C)C)CCCO1 |
| InChI | InChI=1S/C10H17NO/c1-4-10-8-11(9(2)3)6-5-7-12-10/h1,9-10H,5-8H2,2-3H3 |
| InChIKey | LLHPXWGHVJSTKE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-4-propan-2-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-4-propan-2-yl-1,4-oxazepane?
The IUPAC name of 2-ethynyl-4-propan-2-yl-1,4-oxazepane (CID 176594331) is 2-ethynyl-4-propan-2-yl-1,4-oxazepane.
What is the SMILES notation for 2-ethynyl-4-propan-2-yl-1,4-oxazepane?
The canonical SMILES for 2-ethynyl-4-propan-2-yl-1,4-oxazepane is C#CC1CN(C(C)C)CCCO1.
What is the InChIKey of 2-ethynyl-4-propan-2-yl-1,4-oxazepane?
The InChIKey is LLHPXWGHVJSTKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-10-8-11(9(2)3)6-5-7-12-10/h1,9-10H,5-8H2,2-3H3.
What are the key properties of 2-ethynyl-4-propan-2-yl-1,4-oxazepane?
2-ethynyl-4-propan-2-yl-1,4-oxazepane has a molecular weight of 167.25 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-4-propan-2-yl-1,4-oxazepane is sourced from PubChem (CID 176594331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).