C10H17NO — CID 176594331
2-ethynyl-4-propan-2-yl-1,4-oxazepane (PubChem CID 176594331) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-ethynyl-4-propan-2-yl-1,4-oxazepane.
| Compound Name | 2-ethynyl-4-propan-2-yl-1,4-oxazepane |
|---|---|
| PubChem CID | 176594331 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-ethynyl-4-propan-2-yl-1,4-oxazepane |
| SMILES | C#CC1CN(C(C)C)CCCO1 |
| InChI | InChI=1S/C10H17NO/c1-4-10-8-11(9(2)3)6-5-7-12-10/h1,9-10H,5-8H2,2-3H3 |
| InChIKey | LLHPXWGHVJSTKE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|