C34H49N2O12S- — CID 176596156
[3,5-bis[[(2S)-2-(carboxymethyl)-4-methylpentyl]carbamoyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] sulfate (PubChem CID 176596156) has the molecular formula C34H49N2O12S- and a molecular weight of 709.83 g/mol. Its IUPAC name is [3,5-bis[[(2S)-2-(carboxymethyl)-4-methylpentyl]carbamoyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] sulfate.
| Compound Name | [3,5-bis[[(2S)-2-(carboxymethyl)-4-methylpentyl]carbamoyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] sulfate |
|---|---|
| PubChem CID | 176596156 |
| Molecular Formula | C34H49N2O12S- |
| Molecular Weight | 709.83 g/mol |
| Exact Mass | 709.30 |
| IUPAC Name | [3,5-bis[[(2S)-2-(carboxymethyl)-4-methylpentyl]carbamoyloxy]-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] sulfate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(OC(=O)NC[C@H](CC(=O)O)CC(C)C)cc(OC(=O)NCC(CC(=O)O)CC(C)C)cc1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C34H50N2O12S/c1-19(2)10-23(13-30(37)38)17-35-33(41)46-25-15-28(47-34(42)36-18-24(11-20(3)4)14-31(39)40)32(29(16-25)48-49(43,44)45)27-12-22(7)8-9-26(27)21(5)6/h12,15-16,19-20,23-24,26-27H,5,8-11,13-14,17-18H2,1-4,6-7H3,(H,35,41)(H,36,42)(H,37,38)(H,39,40)(H,43,44,45)/p-1/t23?,24-,26-,27+/m0/s1 |
| InChIKey | WVCNNPKZZMVCKF-UHEOGJPGSA-M |
| XLogP | 5.99 |
| TPSA | 217.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.83 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|