C19H26N2O3 — CID 138698775
[3-methoxy-5-(methylamino)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenyl] carbamate (PubChem CID 138698775) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [3-methoxy-5-(methylamino)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenyl] carbamate.
| Compound Name | [3-methoxy-5-(methylamino)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenyl] carbamate |
|---|---|
| PubChem CID | 138698775 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [3-methoxy-5-(methylamino)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenyl] carbamate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OC)cc(NC)cc1OC(N)=O |
| InChI | InChI=1S/C19H26N2O3/c1-11(2)14-7-6-12(3)8-15(14)18-16(23-5)9-13(21-4)10-17(18)24-19(20)22/h8-10,14-15,21H,1,6-7H2,2-5H3,(H2,20,22) |
| InChIKey | LXGNKDFUVIVOLV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|