C21H14I3O7S- — CID 176596757
4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxy]-2-phenylbenzenesulfonate (PubChem CID 176596757) has the molecular formula C21H14I3O7S- and a molecular weight of 791.11 g/mol. Its IUPAC name is 4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxy]-2-phenylbenzenesulfonate.
| Compound Name | 4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxy]-2-phenylbenzenesulfonate |
|---|---|
| PubChem CID | 176596757 |
| Molecular Formula | C21H14I3O7S- |
| Molecular Weight | 791.11 g/mol |
| Exact Mass | 790.76 |
| IUPAC Name | 4-[2-(3-hydroxy-2,4,6-triiodobenzoyl)oxyethoxy]-2-phenylbenzenesulfonate |
| SMILES | O=C(OCCOc1ccc(S(=O)(=O)[O-])c(-c2ccccc2)c1)c1c(I)cc(I)c(O)c1I |
| InChI | InChI=1S/C21H15I3O7S/c22-15-11-16(23)20(25)19(24)18(15)21(26)31-9-8-30-13-6-7-17(32(27,28)29)14(10-13)12-4-2-1-3-5-12/h1-7,10-11,25H,8-9H2,(H,27,28,29)/p-1 |
| InChIKey | XRDOLAIJQJNPKS-UHFFFAOYSA-M |
| XLogP | 5.01 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.11 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|