C25H34N2O3 — CID 176600583
N-[1-(4-butoxyphenyl)cyclopropyl]-5-[2-(dimethylamino)ethoxy]-2-methylbenzamide (PubChem CID 176600583) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[1-(4-butoxyphenyl)cyclopropyl]-5-[2-(dimethylamino)ethoxy]-2-methylbenzamide.
| Compound Name | N-[1-(4-butoxyphenyl)cyclopropyl]-5-[2-(dimethylamino)ethoxy]-2-methylbenzamide |
|---|---|
| PubChem CID | 176600583 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[1-(4-butoxyphenyl)cyclopropyl]-5-[2-(dimethylamino)ethoxy]-2-methylbenzamide |
| SMILES | CCCCOc1ccc(C2(NC(=O)c3cc(OCCN(C)C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C25H34N2O3/c1-5-6-16-29-21-11-8-20(9-12-21)25(13-14-25)26-24(28)23-18-22(10-7-19(23)2)30-17-15-27(3)4/h7-12,18H,5-6,13-17H2,1-4H3,(H,26,28) |
| InChIKey | DFUQRVLHLRSOKG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|