C42H41BN2O2 — CID 176602067
6,6,9,9,21,21-hexamethyl-4,26-diphenyl-12,18-dioxa-14,16-diaza-1-boraheptacyclo[15.11.1.02,11.05,10.013,29.019,28.020,25]nonacosa-2,4,10,13,15,17(29),19,25,27-nonaene (PubChem CID 176602067) has the molecular formula C42H41BN2O2 and a molecular weight of 616.61 g/mol. Its IUPAC name is 6,6,9,9,21,21-hexamethyl-4,26-diphenyl-12,18-dioxa-14,16-diaza-1-boraheptacyclo[15.11.1.02,11.05,10.013,29.019,28.020,25]nonacosa-2,4,10,13,15,17(29),19,25,27-nonaene.
| Compound Name | 6,6,9,9,21,21-hexamethyl-4,26-diphenyl-12,18-dioxa-14,16-diaza-1-boraheptacyclo[15.11.1.02,11.05,10.013,29.019,28.020,25]nonacosa-2,4,10,13,15,17(29),19,25,27-nonaene |
|---|---|
| PubChem CID | 176602067 |
| Molecular Formula | C42H41BN2O2 |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | 6,6,9,9,21,21-hexamethyl-4,26-diphenyl-12,18-dioxa-14,16-diaza-1-boraheptacyclo[15.11.1.02,11.05,10.013,29.019,28.020,25]nonacosa-2,4,10,13,15,17(29),19,25,27-nonaene |
| SMILES | CC1(C)CCCc2c(-c3ccccc3)cc3c(c21)Oc1ncnc2c1B3c1cc(-c3ccccc3)c3c(c1O2)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C42H41BN2O2/c1-40(2)19-13-18-27-28(25-14-9-7-10-15-25)22-30-36(33(27)40)46-38-35-39(45-24-44-38)47-37-31(43(30)35)23-29(26-16-11-8-12-17-26)32-34(37)42(5,6)21-20-41(32,3)4/h7-12,14-17,22-24H,13,18-21H2,1-6H3 |
| InChIKey | NVJXHYBDHCXHQS-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|