C23H23O+ — CID 3796857
8,8-dimethyl-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium (PubChem CID 3796857) has the molecular formula C23H23O+ and a molecular weight of 315.44 g/mol. Its IUPAC name is 8,8-dimethyl-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium.
| Compound Name | 8,8-dimethyl-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium |
|---|---|
| PubChem CID | 3796857 |
| Molecular Formula | C23H23O+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 8,8-dimethyl-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium |
| SMILES | CC1(C)CCCc2c(-c3ccccc3)cc(-c3ccccc3)[o+]c21 |
| InChI | InChI=1S/C23H23O/c1-23(2)15-9-14-19-20(17-10-5-3-6-11-17)16-21(24-22(19)23)18-12-7-4-8-13-18/h3-8,10-13,16H,9,14-15H2,1-2H3/q+1 |
| InChIKey | ABLLZPVTBUJBPN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|