C28H19O2+ — CID 3762975
4,6-diphenyl-9-oxa-3-oxoniatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),3,5,11,13,15,17-octaene (PubChem CID 3762975) has the molecular formula C28H19O2+ and a molecular weight of 387.46 g/mol. Its IUPAC name is 4,6-diphenyl-9-oxa-3-oxoniatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),3,5,11,13,15,17-octaene.
| Compound Name | 4,6-diphenyl-9-oxa-3-oxoniatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),3,5,11,13,15,17-octaene |
|---|---|
| PubChem CID | 3762975 |
| Molecular Formula | C28H19O2+ |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4,6-diphenyl-9-oxa-3-oxoniatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2(7),3,5,11,13,15,17-octaene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c3c([o+]2)-c2c(ccc4ccccc24)OC3)cc1 |
| InChI | InChI=1S/C28H19O2/c1-3-9-19(10-4-1)23-17-26(21-12-5-2-6-13-21)30-28-24(23)18-29-25-16-15-20-11-7-8-14-22(20)27(25)28/h1-17H,18H2/q+1 |
| InChIKey | NUYAFDMNHOGJII-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|