C16H14O — CID 175714628
8-methyl-13-oxatricyclo[8.6.0.011,14]hexadeca-1(10),2,4,6,8,11(14),15-heptaene (PubChem CID 175714628) has the molecular formula C16H14O and a molecular weight of 222.29 g/mol. Its IUPAC name is 8-methyl-13-oxatricyclo[8.6.0.011,14]hexadeca-1(10),2,4,6,8,11(14),15-heptaene.
| Compound Name | 8-methyl-13-oxatricyclo[8.6.0.011,14]hexadeca-1(10),2,4,6,8,11(14),15-heptaene |
|---|---|
| PubChem CID | 175714628 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 8-methyl-13-oxatricyclo[8.6.0.011,14]hexadeca-1(10),2,4,6,8,11(14),15-heptaene |
| SMILES | Cc1ccccccc2ccc3c(c2c1)CO3 |
| InChI | InChI=1S/C16H14O/c1-12-6-4-2-3-5-7-13-8-9-16-15(11-17-16)14(13)10-12/h2-10H,11H2,1H3/b3-2-,4-2-,5-3+,6-4-,7-5+,12-6+,12-10+,13-7-,14-10+ |
| InChIKey | TXUDKXKCIKNYPC-MBRRLHBWSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |