C12H20OS — CID 176604862
2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-7-thiabicyclo[2.2.1]heptane (PubChem CID 176604862) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-7-thiabicyclo[2.2.1]heptane.
| Compound Name | 2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-7-thiabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176604862 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-7-thiabicyclo[2.2.1]heptane |
| SMILES | C/C=C/OCCC1(C)CC2CCC1S2 |
| InChI | InChI=1S/C12H20OS/c1-3-7-13-8-6-12(2)9-10-4-5-11(12)14-10/h3,7,10-11H,4-6,8-9H2,1-2H3/b7-3+ |
| InChIKey | RUZVDBSKMOBEAN-XVNBXDOJSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|