C8H14O5S2 — CID 176605023
2-(ethenoxymethyl)-2-methyl-1,4-dithiane 1,1,4,4-tetraoxide (PubChem CID 176605023) has the molecular formula C8H14O5S2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(ethenoxymethyl)-2-methyl-1,4-dithiane 1,1,4,4-tetraoxide.
| Compound Name | 2-(ethenoxymethyl)-2-methyl-1,4-dithiane 1,1,4,4-tetraoxide |
|---|---|
| PubChem CID | 176605023 |
| Molecular Formula | C8H14O5S2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-(ethenoxymethyl)-2-methyl-1,4-dithiane 1,1,4,4-tetraoxide |
| SMILES | C=COCC1(C)CS(=O)(=O)CCS1(=O)=O |
| InChI | InChI=1S/C8H14O5S2/c1-3-13-6-8(2)7-14(9,10)4-5-15(8,11)12/h3H,1,4-7H2,2H3 |
| InChIKey | GSBYKEWHEDIKMZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|