C31H25N3PtS2 — CID 176606109
2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]sulfanyl]-7-methylquinoline-8-thiolate;platinum(2+) (PubChem CID 176606109) has the molecular formula C31H25N3PtS2 and a molecular weight of 698.77 g/mol. Its IUPAC name is 2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]sulfanyl]-7-methylquinoline-8-thiolate;platinum(2+).
| Compound Name | 2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]sulfanyl]-7-methylquinoline-8-thiolate;platinum(2+) |
|---|---|
| PubChem CID | 176606109 |
| Molecular Formula | C31H25N3PtS2 |
| Molecular Weight | 698.77 g/mol |
| Exact Mass | 698.11 |
| IUPAC Name | 2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]sulfanyl]-7-methylquinoline-8-thiolate;platinum(2+) |
| SMILES | Cc1ccc2ccc(Sc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)nc2c1[S-].[Pt+2] |
| InChI | InChI=1S/C31H26N3S2.Pt/c1-19-9-10-20-11-14-28(33-29(20)30(19)35)36-22-12-13-24-23-7-5-6-8-25(23)34(26(24)18-22)27-17-21(15-16-32-27)31(2,3)4;/h5-17,35H,1-4H3;/q-1;+2/p-1 |
| InChIKey | LKWSTBGHMPMATL-UHFFFAOYSA-M |
| XLogP | 8.19 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.77 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|