C15H26ClNO — CID 176612879
(2R,3R,4R,5S)-4-chloro-4-ethynyl-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine (PubChem CID 176612879) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-chloro-4-ethynyl-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine.
| Compound Name | (2R,3R,4R,5S)-4-chloro-4-ethynyl-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
|---|---|
| PubChem CID | 176612879 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2R,3R,4R,5S)-4-chloro-4-ethynyl-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
| SMILES | C#C[C@]1(Cl)[C@H](C(C)C)O[C@H](CC(C)C)[C@H]1N(C)C |
| InChI | InChI=1S/C15H26ClNO/c1-8-15(16)13(17(6)7)12(9-10(2)3)18-14(15)11(4)5/h1,10-14H,9H2,2-7H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | IHMCHJGYONWHNU-APIJFGDWSA-N |
| XLogP | 3.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|