C16H27NO3 — CID 176613140
[(2R,3S,4S,5S)-4-ethynyl-4-(methylamino)-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate (PubChem CID 176613140) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-4-ethynyl-4-(methylamino)-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S)-4-ethynyl-4-(methylamino)-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 176613140 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | [(2R,3S,4S,5S)-4-ethynyl-4-(methylamino)-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate |
| SMILES | C#C[C@@]1(NC)[C@H](OC(C)=O)[C@@H](CC(C)C)O[C@H]1C(C)C |
| InChI | InChI=1S/C16H27NO3/c1-8-16(17-7)14(11(4)5)20-13(9-10(2)3)15(16)19-12(6)18/h1,10-11,13-15,17H,9H2,2-7H3/t13-,14+,15-,16+/m1/s1 |
| InChIKey | NFIAZGSEQNOBCZ-QXSJWSMHSA-N |
| XLogP | 1.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|