C13H22O3 — CID 176613054
(2S,3R,4R,5R)-3-ethynyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diol (PubChem CID 176613054) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S,3R,4R,5R)-3-ethynyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-3-ethynyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diol |
|---|---|
| PubChem CID | 176613054 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2S,3R,4R,5R)-3-ethynyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diol |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](CC(C)C)O[C@H]1C(C)C |
| InChI | InChI=1S/C13H22O3/c1-6-13(15)11(14)10(7-8(2)3)16-12(13)9(4)5/h1,8-12,14-15H,7H2,2-5H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | DFGMLETWVITJQJ-FVCCEPFGSA-N |
| XLogP | 1.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|