C14H24FNO — CID 176613155
(2R,3S,4R,5S)-4-ethynyl-4-fluoro-N-methyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine (PubChem CID 176613155) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is (2R,3S,4R,5S)-4-ethynyl-4-fluoro-N-methyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine.
| Compound Name | (2R,3S,4R,5S)-4-ethynyl-4-fluoro-N-methyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
|---|---|
| PubChem CID | 176613155 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (2R,3S,4R,5S)-4-ethynyl-4-fluoro-N-methyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
| SMILES | C#C[C@]1(F)[C@H](C(C)C)O[C@H](CC(C)C)[C@@H]1NC |
| InChI | InChI=1S/C14H24FNO/c1-7-14(15)12(16-6)11(8-9(2)3)17-13(14)10(4)5/h1,9-13,16H,8H2,2-6H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | UGYFCNMJVHALNJ-ZOBORPQBSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|