C21H17N3O — CID 176615733
(2R,3S)-3-(4-ethynylphenyl)-N-quinolin-8-ylazetidine-2-carboxamide (PubChem CID 176615733) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is (2R,3S)-3-(4-ethynylphenyl)-N-quinolin-8-ylazetidine-2-carboxamide.
| Compound Name | (2R,3S)-3-(4-ethynylphenyl)-N-quinolin-8-ylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 176615733 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2R,3S)-3-(4-ethynylphenyl)-N-quinolin-8-ylazetidine-2-carboxamide |
| SMILES | C#Cc1ccc([C@H]2CN[C@H]2C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C21H17N3O/c1-2-14-8-10-15(11-9-14)17-13-23-20(17)21(25)24-18-7-3-5-16-6-4-12-22-19(16)18/h1,3-12,17,20,23H,13H2,(H,24,25)/t17-,20-/m1/s1 |
| InChIKey | NYVVNNSMOCJGSQ-YLJYHZDGSA-N |
| XLogP | 2.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|