C19H16ClFN4O — CID 177228252
(2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-N-quinolin-8-ylpyrrolidine-2-carboxamide (PubChem CID 177228252) has the molecular formula C19H16ClFN4O and a molecular weight of 370.82 g/mol. Its IUPAC name is (2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-N-quinolin-8-ylpyrrolidine-2-carboxamide.
| Compound Name | (2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-N-quinolin-8-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 177228252 |
| Molecular Formula | C19H16ClFN4O |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-N-quinolin-8-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)[C@@H]1NCC[C@@H]1c1cnc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H16ClFN4O/c20-18-14(21)9-12(10-24-18)13-6-8-23-17(13)19(26)25-15-5-1-3-11-4-2-7-22-16(11)15/h1-5,7,9-10,13,17,23H,6,8H2,(H,25,26)/t13-,17-/m1/s1 |
| InChIKey | PIXGEQSFRWYXOC-CXAGYDPISA-N |
| XLogP | 3.51 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|