C34H26ClFN4O3 — CID 177228282
9H-fluoren-9-ylmethyl (2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 177228282) has the molecular formula C34H26ClFN4O3 and a molecular weight of 593.06 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177228282 |
| Molecular Formula | C34H26ClFN4O3 |
| Molecular Weight | 593.06 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R,3R)-3-(6-chloro-5-fluoro-3-pyridinyl)-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1cccc2cccnc12)[C@H]1[C@@H](c2cnc(Cl)c(F)c2)CCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H26ClFN4O3/c35-32-28(36)17-21(18-38-32)22-14-16-40(31(22)33(41)39-29-13-5-7-20-8-6-15-37-30(20)29)34(42)43-19-27-25-11-3-1-9-23(25)24-10-2-4-12-26(24)27/h1-13,15,17-18,22,27,31H,14,16,19H2,(H,39,41)/t22-,31-/m1/s1 |
| InChIKey | FOEJJZOVNKFQLE-JPZYQRIQSA-N |
| XLogP | 7.17 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.06 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|