C64H59IrN5O2-2 — CID 176617896
CID 176617896 (PubChem CID 176617896) has the molecular formula C64H59IrN5O2-2 and a molecular weight of 1128.46 g/mol.
| Compound Name | CID 176617896 |
|---|---|
| PubChem CID | 176617896 |
| Molecular Formula | C64H59IrN5O2-2 |
| Molecular Weight | 1128.46 g/mol |
| Exact Mass | 1128.47 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)n1.[2H]C([2H])([2H])c1c[c-]c(-c2nc3cccc(C([2H])([2H])[2H])c3n2-c2c(C(C)C)cc(-c3ccc(C(C)(C)C)cc3)cc2C(C)C)c2oc3cc4c(cc3c12)oc1cc(C#N)ccc14.[Ir] |
| InChI | InChI=1S/C50H44N3O2.C14H15N2.Ir/c1-27(2)37-22-33(32-15-17-34(18-16-32)50(7,8)9)23-38(28(3)4)47(37)53-46-30(6)11-10-12-41(46)52-49(53)36-19-13-29(5)45-40-25-43-39(24-44(40)55-48(36)45)35-20-14-31(26-51)21-42(35)54-43;1-14(2,3)12-9-10-15-13(16-12)11-7-5-4-6-8-11;/h10-18,20-25,27-28H,1-9H3;4-7,9-10H,1-3H3;/q2*-1;/i5D3,6D3;; |
| InChIKey | MMFBBLSPSMHFOG-NWXAPCBASA-N |
| XLogP | 17.23 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.46 |
| LogP ≤ 5 | 17.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|