C17H30N2O4 — CID 176629244
butyl (2S,4R)-1-[(2S)-2-amino-2-(1-methylcyclopentyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 176629244) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is butyl (2S,4R)-1-[(2S)-2-amino-2-(1-methylcyclopentyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | butyl (2S,4R)-1-[(2S)-2-amino-2-(1-methylcyclopentyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 176629244 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | butyl (2S,4R)-1-[(2S)-2-amino-2-(1-methylcyclopentyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](N)C1(C)CCCC1 |
| InChI | InChI=1S/C17H30N2O4/c1-3-4-9-23-16(22)13-10-12(20)11-19(13)15(21)14(18)17(2)7-5-6-8-17/h12-14,20H,3-11,18H2,1-2H3/t12-,13+,14-/m1/s1 |
| InChIKey | CAIXLOMONJHHGZ-HZSPNIEDSA-N |
| XLogP | 1.20 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|