C12H20N4O4 — CID 178018527
ethyl (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 178018527) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is ethyl (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 178018527 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](N=[N+]=[N-])C(C)C |
| InChI | InChI=1S/C12H20N4O4/c1-4-20-12(19)9-5-8(17)6-16(9)11(18)10(7(2)3)14-15-13/h7-10,17H,4-6H2,1-3H3/t8-,9+,10+/m1/s1 |
| InChIKey | JIVGOWHKLCCQCE-UTLUCORTSA-N |
| XLogP | 0.85 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|