C21H13Cl3N6O — CID 176630106
12-[4-(chloromethyl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,9,11-pentaen-8-one (PubChem CID 176630106) has the molecular formula C21H13Cl3N6O and a molecular weight of 471.74 g/mol. Its IUPAC name is 12-[4-(chloromethyl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,9,11-pentaen-8-one.
| Compound Name | 12-[4-(chloromethyl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,9,11-pentaen-8-one |
|---|---|
| PubChem CID | 176630106 |
| Molecular Formula | C21H13Cl3N6O |
| Molecular Weight | 471.74 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 12-[4-(chloromethyl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,9,11-pentaen-8-one |
| SMILES | O=c1c2cnc(Nc3ccc(CCl)cc3)nc2n2ccnc2n1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H13Cl3N6O/c22-10-12-4-6-13(7-5-12)27-20-26-11-14-18(28-20)29-9-8-25-21(29)30(19(14)31)17-15(23)2-1-3-16(17)24/h1-9,11H,10H2,(H,26,27,28) |
| InChIKey | QLCRHCHTCVYYRA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|