C11H9ClFN3 — CID 104606690
N-[4-(chloromethyl)phenyl]-5-fluoropyrimidin-2-amine (PubChem CID 104606690) has the molecular formula C11H9ClFN3 and a molecular weight of 237.67 g/mol. Its IUPAC name is N-[4-(chloromethyl)phenyl]-5-fluoropyrimidin-2-amine.
| Compound Name | N-[4-(chloromethyl)phenyl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 104606690 |
| Molecular Formula | C11H9ClFN3 |
| Molecular Weight | 237.67 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | N-[4-(chloromethyl)phenyl]-5-fluoropyrimidin-2-amine |
| SMILES | Fc1cnc(Nc2ccc(CCl)cc2)nc1 |
| InChI | InChI=1S/C11H9ClFN3/c12-5-8-1-3-10(4-2-8)16-11-14-6-9(13)7-15-11/h1-4,6-7H,5H2,(H,14,15,16) |
| InChIKey | ASJZBOZHXZLTQM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|