C28H26FN3O3 — CID 176637840
N-[2-(3-acetylphenyl)-3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-carboxamide (PubChem CID 176637840) has the molecular formula C28H26FN3O3 and a molecular weight of 471.53 g/mol. Its IUPAC name is N-[2-(3-acetylphenyl)-3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-carboxamide.
| Compound Name | N-[2-(3-acetylphenyl)-3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 176637840 |
| Molecular Formula | C28H26FN3O3 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[2-(3-acetylphenyl)-3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]furan-2-carboxamide |
| SMILES | CC(=O)c1cccc(-c2nc(-c3ccc(F)cc3)c(NC(=O)c3ccco3)n2C2CCCCC2)c1 |
| InChI | InChI=1S/C28H26FN3O3/c1-18(33)20-7-5-8-21(17-20)26-30-25(19-12-14-22(29)15-13-19)27(31-28(34)24-11-6-16-35-24)32(26)23-9-3-2-4-10-23/h5-8,11-17,23H,2-4,9-10H2,1H3,(H,31,34) |
| InChIKey | BWETYAXDXNDIGP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |